C23H20N4OS — CID 112809355
5-[(benzhydrylamino)methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide (PubChem CID 112809355) has the molecular formula C23H20N4OS and a molecular weight of 400.51 g/mol. Its IUPAC name is 5-[(benzhydrylamino)methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide.
| Compound Name | 5-[(benzhydrylamino)methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide |
|---|---|
| PubChem CID | 112809355 |
| Molecular Formula | C23H20N4OS |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 5-[(benzhydrylamino)methyl]-N-phenyl-1,3,4-thiadiazole-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1nnc(CNC(c2ccccc2)c2ccccc2)s1 |
| InChI | InChI=1S/C23H20N4OS/c28-22(25-19-14-8-3-9-15-19)23-27-26-20(29-23)16-24-21(17-10-4-1-5-11-17)18-12-6-2-7-13-18/h1-15,21,24H,16H2,(H,25,28) |
| InChIKey | SAIJCYVEDKMOOL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |