C25H25N5O3 — CID 112809521
4-benzyl-N-(3-imidazol-1-ylpropyl)-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazoline-3a-carboxamide (PubChem CID 112809521) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is 4-benzyl-N-(3-imidazol-1-ylpropyl)-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazoline-3a-carboxamide.
| Compound Name | 4-benzyl-N-(3-imidazol-1-ylpropyl)-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazoline-3a-carboxamide |
|---|---|
| PubChem CID | 112809521 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 4-benzyl-N-(3-imidazol-1-ylpropyl)-1,5-dioxo-2,3-dihydropyrrolo[1,2-a]quinazoline-3a-carboxamide |
| SMILES | O=C1c2ccccc2N2C(=O)CCC2(C(=O)NCCCn2ccnc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H25N5O3/c31-22-11-12-25(24(33)27-13-6-15-28-16-14-26-18-28)29(17-19-7-2-1-3-8-19)23(32)20-9-4-5-10-21(20)30(22)25/h1-5,7-10,14,16,18H,6,11-13,15,17H2,(H,27,33) |
| InChIKey | PTVMYZSIMDOLAB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|