C22H27N3OS2 — CID 112809982
2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-[3-(N-ethylanilino)propyl]benzamide (PubChem CID 112809982) has the molecular formula C22H27N3OS2 and a molecular weight of 413.61 g/mol. Its IUPAC name is 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-[3-(N-ethylanilino)propyl]benzamide.
| Compound Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-[3-(N-ethylanilino)propyl]benzamide |
|---|---|
| PubChem CID | 112809982 |
| Molecular Formula | C22H27N3OS2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-(4,5-dihydro-1,3-thiazol-2-ylsulfanylmethyl)-N-[3-(N-ethylanilino)propyl]benzamide |
| SMILES | CCN(CCCNC(=O)c1ccccc1CSC1=NCCS1)c1ccccc1 |
| InChI | InChI=1S/C22H27N3OS2/c1-2-25(19-10-4-3-5-11-19)15-8-13-23-21(26)20-12-7-6-9-18(20)17-28-22-24-14-16-27-22/h3-7,9-12H,2,8,13-17H2,1H3,(H,23,26) |
| InChIKey | JELXSWZCENYYGZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|