C28H32O2 — CID 11281039
2-[4-[(3,5,5,8,8-pentamethylnaphthalen-2-yl)methyl]phenyl]cyclohexane-1,3-dione (PubChem CID 11281039) has the molecular formula C28H32O2 and a molecular weight of 400.56 g/mol. Its IUPAC name is 2-[4-[(3,5,5,8,8-pentamethylnaphthalen-2-yl)methyl]phenyl]cyclohexane-1,3-dione.
| Compound Name | 2-[4-[(3,5,5,8,8-pentamethylnaphthalen-2-yl)methyl]phenyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 11281039 |
| Molecular Formula | C28H32O2 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 2-[4-[(3,5,5,8,8-pentamethylnaphthalen-2-yl)methyl]phenyl]cyclohexane-1,3-dione |
| SMILES | Cc1cc2c(cc1Cc1ccc(C3C(=O)CCCC3=O)cc1)C(C)(C)C=CC2(C)C |
| InChI | InChI=1S/C28H32O2/c1-18-15-22-23(28(4,5)14-13-27(22,2)3)17-21(18)16-19-9-11-20(12-10-19)26-24(29)7-6-8-25(26)30/h9-15,17,26H,6-8,16H2,1-5H3 |
| InChIKey | MSWGPUUNEPHJJO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|