C21H15N5O2S — CID 11281058
4-[8-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-2-(1-benzothiophen-3-yl)but-3-yn-2-ol (PubChem CID 11281058) has the molecular formula C21H15N5O2S and a molecular weight of 401.45 g/mol. Its IUPAC name is 4-[8-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-2-(1-benzothiophen-3-yl)but-3-yn-2-ol.
| Compound Name | 4-[8-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-2-(1-benzothiophen-3-yl)but-3-yn-2-ol |
|---|---|
| PubChem CID | 11281058 |
| Molecular Formula | C21H15N5O2S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 4-[8-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-2-(1-benzothiophen-3-yl)but-3-yn-2-ol |
| SMILES | CC(O)(C#Cc1cn2nc(-c3ccco3)nc2c(N)n1)c1csc2ccccc12 |
| InChI | InChI=1S/C21H15N5O2S/c1-21(27,15-12-29-17-7-3-2-5-14(15)17)9-8-13-11-26-20(18(22)23-13)24-19(25-26)16-6-4-10-28-16/h2-7,10-12,27H,1H3,(H2,22,23) |
| InChIKey | XVKNSTAQDGYKDL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|