C25H38O4 — CID 11281105
(11E)-24-methoxy-22-oxabicyclo[19.2.2]pentacosa-1(24),11,21(25)-triene-2,23-dione (PubChem CID 11281105) has the molecular formula C25H38O4 and a molecular weight of 402.58 g/mol. Its IUPAC name is (11E)-24-methoxy-22-oxabicyclo[19.2.2]pentacosa-1(24),11,21(25)-triene-2,23-dione.
| Compound Name | (11E)-24-methoxy-22-oxabicyclo[19.2.2]pentacosa-1(24),11,21(25)-triene-2,23-dione |
|---|---|
| PubChem CID | 11281105 |
| Molecular Formula | C25H38O4 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | (11E)-24-methoxy-22-oxabicyclo[19.2.2]pentacosa-1(24),11,21(25)-triene-2,23-dione |
| SMILES | COc1cc2oc(=O)c1C(=O)CCCCCCCC/C=C/CCCCCCCC2 |
| InChI | InChI=1S/C25H38O4/c1-28-23-20-21-18-16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-19-22(26)24(23)25(27)29-21/h2-3,20H,4-19H2,1H3/b3-2+ |
| InChIKey | PVVMEWYYIGMUNH-NSCUHMNNSA-N |
| XLogP | 6.79 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|