C21H24N2O2 — CID 112811052
N-[1-(1-benzofuran-2-yl)ethyl]-2-(3,5-dimethylanilino)propanamide (PubChem CID 112811052) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethyl]-2-(3,5-dimethylanilino)propanamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethyl]-2-(3,5-dimethylanilino)propanamide |
|---|---|
| PubChem CID | 112811052 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethyl]-2-(3,5-dimethylanilino)propanamide |
| SMILES | Cc1cc(C)cc(NC(C)C(=O)NC(C)c2cc3ccccc3o2)c1 |
| InChI | InChI=1S/C21H24N2O2/c1-13-9-14(2)11-18(10-13)22-16(4)21(24)23-15(3)20-12-17-7-5-6-8-19(17)25-20/h5-12,15-16,22H,1-4H3,(H,23,24) |
| InChIKey | KQHYSFHFWMKDCF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |