C17H27ClN2O — CID 112811643
2-[1-(4-chlorophenyl)propylamino]-N-(2-methylbutan-2-yl)propanamide (PubChem CID 112811643) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is 2-[1-(4-chlorophenyl)propylamino]-N-(2-methylbutan-2-yl)propanamide.
| Compound Name | 2-[1-(4-chlorophenyl)propylamino]-N-(2-methylbutan-2-yl)propanamide |
|---|---|
| PubChem CID | 112811643 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-[1-(4-chlorophenyl)propylamino]-N-(2-methylbutan-2-yl)propanamide |
| SMILES | CCC(NC(C)C(=O)NC(C)(C)CC)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H27ClN2O/c1-6-15(13-8-10-14(18)11-9-13)19-12(3)16(21)20-17(4,5)7-2/h8-12,15,19H,6-7H2,1-5H3,(H,20,21) |
| InChIKey | ZRDQIMUZVIDZBR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |