C24H30N4O — CID 112811721
2-[4-[cyano(phenyl)methyl]piperazin-1-yl]-N-[1-(2-methylphenyl)ethyl]propanamide (PubChem CID 112811721) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is 2-[4-[cyano(phenyl)methyl]piperazin-1-yl]-N-[1-(2-methylphenyl)ethyl]propanamide.
| Compound Name | 2-[4-[cyano(phenyl)methyl]piperazin-1-yl]-N-[1-(2-methylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 112811721 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 2-[4-[cyano(phenyl)methyl]piperazin-1-yl]-N-[1-(2-methylphenyl)ethyl]propanamide |
| SMILES | Cc1ccccc1C(C)NC(=O)C(C)N1CCN(C(C#N)c2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N4O/c1-18-9-7-8-12-22(18)19(2)26-24(29)20(3)27-13-15-28(16-14-27)23(17-25)21-10-5-4-6-11-21/h4-12,19-20,23H,13-16H2,1-3H3,(H,26,29) |
| InChIKey | PDCGTTKWZPAZRD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |