C19H16Cl2N2O4 — CID 112813072
1-[2-(2,5-dichlorophenoxy)ethyl]-3-(1-phenylethyl)imidazolidine-2,4,5-trione (PubChem CID 112813072) has the molecular formula C19H16Cl2N2O4 and a molecular weight of 407.25 g/mol. Its IUPAC name is 1-[2-(2,5-dichlorophenoxy)ethyl]-3-(1-phenylethyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[2-(2,5-dichlorophenoxy)ethyl]-3-(1-phenylethyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 112813072 |
| Molecular Formula | C19H16Cl2N2O4 |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 1-[2-(2,5-dichlorophenoxy)ethyl]-3-(1-phenylethyl)imidazolidine-2,4,5-trione |
| SMILES | CC(c1ccccc1)N1C(=O)C(=O)N(CCOc2cc(Cl)ccc2Cl)C1=O |
| InChI | InChI=1S/C19H16Cl2N2O4/c1-12(13-5-3-2-4-6-13)23-18(25)17(24)22(19(23)26)9-10-27-16-11-14(20)7-8-15(16)21/h2-8,11-12H,9-10H2,1H3 |
| InChIKey | MSGVMPBJTKNDSX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|