C19H30N4O6 — CID 11281315
(2R,3R,4R,5R)-2-[4-amino-5-[di(propan-2-yloxy)methyl]pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol (PubChem CID 11281315) has the molecular formula C19H30N4O6 and a molecular weight of 410.47 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-[4-amino-5-[di(propan-2-yloxy)methyl]pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-[4-amino-5-[di(propan-2-yloxy)methyl]pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 11281315 |
| Molecular Formula | C19H30N4O6 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | (2R,3R,4R,5R)-2-[4-amino-5-[di(propan-2-yloxy)methyl]pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
| SMILES | CC(C)OC(OC(C)C)c1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@@]2(C)O)c2ncnc(N)c12 |
| InChI | InChI=1S/C19H30N4O6/c1-9(2)27-17(28-10(3)4)11-6-23(16-13(11)15(20)21-8-22-16)18-19(5,26)14(25)12(7-24)29-18/h6,8-10,12,14,17-18,24-26H,7H2,1-5H3,(H2,20,21,22)/t12-,14-,18-,19-/m1/s1 |
| InChIKey | MCUXYXLFJBVLDD-NCGUTPBLSA-N |
| XLogP | 0.86 |
| TPSA | 145.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|