C21H25N3O4S — CID 11281456
ethyl 1-cyclohexyl-2-methyl-5-[(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)methoxy]indole-3-carboxylate (PubChem CID 11281456) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is ethyl 1-cyclohexyl-2-methyl-5-[(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)methoxy]indole-3-carboxylate.
| Compound Name | ethyl 1-cyclohexyl-2-methyl-5-[(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)methoxy]indole-3-carboxylate |
|---|---|
| PubChem CID | 11281456 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | ethyl 1-cyclohexyl-2-methyl-5-[(2-sulfanylidene-3H-1,3,4-oxadiazol-5-yl)methoxy]indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(C2CCCCC2)c2ccc(OCc3n[nH]c(=S)o3)cc12 |
| InChI | InChI=1S/C21H25N3O4S/c1-3-26-20(25)19-13(2)24(14-7-5-4-6-8-14)17-10-9-15(11-16(17)19)27-12-18-22-23-21(29)28-18/h9-11,14H,3-8,12H2,1-2H3,(H,23,29) |
| InChIKey | NKOSHKSZBKPGNZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|