C22H25NO3 — CID 1128148
[(2R,4S)-1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl] butanoate (PubChem CID 1128148) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is [(2R,4S)-1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl] butanoate.
| Compound Name | [(2R,4S)-1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl] butanoate |
|---|---|
| PubChem CID | 1128148 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [(2R,4S)-1-benzoyl-2,6-dimethyl-3,4-dihydro-2H-quinolin-4-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1C[C@@H](C)N(C(=O)c2ccccc2)c2ccc(C)cc21 |
| InChI | InChI=1S/C22H25NO3/c1-4-8-21(24)26-20-14-16(3)23(19-12-11-15(2)13-18(19)20)22(25)17-9-6-5-7-10-17/h5-7,9-13,16,20H,4,8,14H2,1-3H3/t16-,20+/m1/s1 |
| InChIKey | QPBRJLNYRUYCSF-UZLBHIALSA-N |
| XLogP | 4.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |