C24H23N3O4 — CID 11281501
3-anilino-5-[2-(oxane-4-carbonylamino)-4-pyridinyl]benzoic acid (PubChem CID 11281501) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 3-anilino-5-[2-(oxane-4-carbonylamino)-4-pyridinyl]benzoic acid.
| Compound Name | 3-anilino-5-[2-(oxane-4-carbonylamino)-4-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 11281501 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 3-anilino-5-[2-(oxane-4-carbonylamino)-4-pyridinyl]benzoic acid |
| SMILES | O=C(O)c1cc(Nc2ccccc2)cc(-c2ccnc(NC(=O)C3CCOCC3)c2)c1 |
| InChI | InChI=1S/C24H23N3O4/c28-23(16-7-10-31-11-8-16)27-22-15-17(6-9-25-22)18-12-19(24(29)30)14-21(13-18)26-20-4-2-1-3-5-20/h1-6,9,12-16,26H,7-8,10-11H2,(H,29,30)(H,25,27,28) |
| InChIKey | QJMYMLCRBFMCCL-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |