About N-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,2-dimethylcyclohexan-1-amine
N-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,2-dimethylcyclohexan-1-amine (PubChem CID 112815161) has the molecular formula C18H23FN2O
and a molecular weight of 302.39 g/mol. Its IUPAC name is N-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,2-dimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | N-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,2-dimethylcyclohexan-1-amine |
| PubChem CID | 112815161 |
| Molecular Formula | C18H23FN2O |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | N-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,2-dimethylcyclohexan-1-amine |
| SMILES | CC1CCCCC1N(C)Cc1ncc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C18H23FN2O/c1-13-5-3-4-6-16(13)21(2)12-18-20-11-17(22-18)14-7-9-15(19)10-8-14/h7-11,13,16H,3-6,12H2,1-2H3 |
| InChIKey | CDFFBLNXMVPCFD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,2-dimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,2-dimethylcyclohexan-1-amine?
The IUPAC name of N-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,2-dimethylcyclohexan-1-amine (CID 112815161) is N-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,2-dimethylcyclohexan-1-amine.
What is the SMILES notation for N-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,2-dimethylcyclohexan-1-amine?
The canonical SMILES for N-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,2-dimethylcyclohexan-1-amine is CC1CCCCC1N(C)Cc1ncc(-c2ccc(F)cc2)o1.
What is the InChIKey of N-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,2-dimethylcyclohexan-1-amine?
The InChIKey is CDFFBLNXMVPCFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23FN2O/c1-13-5-3-4-6-16(13)21(2)12-18-20-11-17(22-18)14-7-9-15(19)10-8-14/h7-11,13,16H,3-6,12H2,1-2H3.
What are the key properties of N-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,2-dimethylcyclohexan-1-amine?
N-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,2-dimethylcyclohexan-1-amine has a molecular weight of 302.39 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[5-(4-fluorophenyl)-1,3-oxazol-2-yl]methyl]-N,2-dimethylcyclohexan-1-amine is sourced from PubChem (CID 112815161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).