C17H28O10Si — CID 11281574
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-trimethylsilyloxyoxan-2-yl]methyl acetate (PubChem CID 11281574) has the molecular formula C17H28O10Si and a molecular weight of 420.49 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-trimethylsilyloxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-trimethylsilyloxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11281574 |
| Molecular Formula | C17H28O10Si |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-trimethylsilyloxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[Si](C)(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H28O10Si/c1-9(18)22-8-13-14(23-10(2)19)15(24-11(3)20)16(25-12(4)21)17(26-13)27-28(5,6)7/h13-17H,8H2,1-7H3/t13-,14-,15+,16-,17+/m1/s1 |
| InChIKey | NRJIIUKUAQBWBU-UUAJXVIYSA-N |
| XLogP | 0.92 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|