C24H42O4Si — CID 11281651
(3S,3aS,5aS,6S,9aS,9bS)-3-[tert-butyl(dimethyl)silyl]oxy-3a,6-dimethylspiro[1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane]-6-carbaldehyde (PubChem CID 11281651) has the molecular formula C24H42O4Si and a molecular weight of 422.68 g/mol. Its IUPAC name is (3S,3aS,5aS,6S,9aS,9bS)-3-[tert-butyl(dimethyl)silyl]oxy-3a,6-dimethylspiro[1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane]-6-carbaldehyde.
| Compound Name | (3S,3aS,5aS,6S,9aS,9bS)-3-[tert-butyl(dimethyl)silyl]oxy-3a,6-dimethylspiro[1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane]-6-carbaldehyde |
|---|---|
| PubChem CID | 11281651 |
| Molecular Formula | C24H42O4Si |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | (3S,3aS,5aS,6S,9aS,9bS)-3-[tert-butyl(dimethyl)silyl]oxy-3a,6-dimethylspiro[1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane]-6-carbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CC[C@H]2[C@@H]3CCC4(OCCO4)[C@](C)(C=O)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H42O4Si/c1-21(2,3)29(6,7)28-20-9-8-18-17-10-13-24(26-14-15-27-24)23(5,16-25)19(17)11-12-22(18,20)4/h16-20H,8-15H2,1-7H3/t17-,18-,19-,20-,22-,23+/m0/s1 |
| InChIKey | MXRKTRMYMDFJRS-AEZRXPCCSA-N |
| XLogP | 5.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|