About 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-hex-1-en-2-yl-2-pyridinyl)pentanamide
2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-hex-1-en-2-yl-2-pyridinyl)pentanamide (PubChem CID 11281819) has the molecular formula C24H29F2N3O2
and a molecular weight of 429.51 g/mol. Its IUPAC name is 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-hex-1-en-2-yl-2-pyridinyl)pentanamide.
Molecular Properties
| Compound Name | 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-hex-1-en-2-yl-2-pyridinyl)pentanamide |
| PubChem CID | 11281819 |
| Molecular Formula | C24H29F2N3O2 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-hex-1-en-2-yl-2-pyridinyl)pentanamide |
| SMILES | C=C(CCCC)c1ccc(NC(=O)C(CCC)NC(=O)Cc2cc(F)cc(F)c2)nc1 |
| InChI | InChI=1S/C24H29F2N3O2/c1-4-6-8-16(3)18-9-10-22(27-15-18)29-24(31)21(7-5-2)28-23(30)13-17-11-19(25)14-20(26)12-17/h9-12,14-15,21H,3-8,13H2,1-2H3,(H,28,30)(H,27,29,31) |
| InChIKey | JVRBTEYSHJSQSQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-hex-1-en-2-yl-2-pyridinyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-hex-1-en-2-yl-2-pyridinyl)pentanamide?
The IUPAC name of 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-hex-1-en-2-yl-2-pyridinyl)pentanamide (CID 11281819) is 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-hex-1-en-2-yl-2-pyridinyl)pentanamide.
What is the SMILES notation for 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-hex-1-en-2-yl-2-pyridinyl)pentanamide?
The canonical SMILES for 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-hex-1-en-2-yl-2-pyridinyl)pentanamide is C=C(CCCC)c1ccc(NC(=O)C(CCC)NC(=O)Cc2cc(F)cc(F)c2)nc1.
What is the InChIKey of 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-hex-1-en-2-yl-2-pyridinyl)pentanamide?
The InChIKey is JVRBTEYSHJSQSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29F2N3O2/c1-4-6-8-16(3)18-9-10-22(27-15-18)29-24(31)21(7-5-2)28-23(30)13-17-11-19(25)14-20(26)12-17/h9-12,14-15,21H,3-8,13H2,1-2H3,(H,28,30)(H,27,29,31).
What are the key properties of 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-hex-1-en-2-yl-2-pyridinyl)pentanamide?
2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-hex-1-en-2-yl-2-pyridinyl)pentanamide has a molecular weight of 429.51 g/mol, XLogP of 5.03, 11 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-(3,5-difluorophenyl)acetyl]amino]-N-(5-hex-1-en-2-yl-2-pyridinyl)pentanamide is sourced from PubChem (CID 11281819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).