C18H14F4N2O — CID 112819165
3,5-dimethyl-1-[4-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]pyrazole (PubChem CID 112819165) has the molecular formula C18H14F4N2O and a molecular weight of 350.32 g/mol. Its IUPAC name is 3,5-dimethyl-1-[4-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]pyrazole.
| Compound Name | 3,5-dimethyl-1-[4-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]pyrazole |
|---|---|
| PubChem CID | 112819165 |
| Molecular Formula | C18H14F4N2O |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 3,5-dimethyl-1-[4-[(2,3,5,6-tetrafluorophenoxy)methyl]phenyl]pyrazole |
| SMILES | Cc1cc(C)n(-c2ccc(COc3c(F)c(F)cc(F)c3F)cc2)n1 |
| InChI | InChI=1S/C18H14F4N2O/c1-10-7-11(2)24(23-10)13-5-3-12(4-6-13)9-25-18-16(21)14(19)8-15(20)17(18)22/h3-8H,9H2,1-2H3 |
| InChIKey | KDWPADZDTNPHTM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|