C23H26ClN3O3 — CID 112819938
4-chloro-N-[3-methyl-1-oxo-1-[3-(2-oxopiperidin-1-yl)anilino]butan-2-yl]benzamide (PubChem CID 112819938) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is 4-chloro-N-[3-methyl-1-oxo-1-[3-(2-oxopiperidin-1-yl)anilino]butan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[3-methyl-1-oxo-1-[3-(2-oxopiperidin-1-yl)anilino]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 112819938 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 4-chloro-N-[3-methyl-1-oxo-1-[3-(2-oxopiperidin-1-yl)anilino]butan-2-yl]benzamide |
| SMILES | CC(C)C(NC(=O)c1ccc(Cl)cc1)C(=O)Nc1cccc(N2CCCCC2=O)c1 |
| InChI | InChI=1S/C23H26ClN3O3/c1-15(2)21(26-22(29)16-9-11-17(24)12-10-16)23(30)25-18-6-5-7-19(14-18)27-13-4-3-8-20(27)28/h5-7,9-12,14-15,21H,3-4,8,13H2,1-2H3,(H,25,30)(H,26,29) |
| InChIKey | HRPJBBZCUVBCLK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |