C22H34N4O3 — CID 112820092
N-cyclohexyl-4-[2-[1-(2-methoxyphenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxamide (PubChem CID 112820092) has the molecular formula C22H34N4O3 and a molecular weight of 402.54 g/mol. Its IUPAC name is N-cyclohexyl-4-[2-[1-(2-methoxyphenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxamide.
| Compound Name | N-cyclohexyl-4-[2-[1-(2-methoxyphenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 112820092 |
| Molecular Formula | C22H34N4O3 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | N-cyclohexyl-4-[2-[1-(2-methoxyphenyl)ethylamino]-2-oxoethyl]piperazine-1-carboxamide |
| SMILES | COc1ccccc1C(C)NC(=O)CN1CCN(C(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C22H34N4O3/c1-17(19-10-6-7-11-20(19)29-2)23-21(27)16-25-12-14-26(15-13-25)22(28)24-18-8-4-3-5-9-18/h6-7,10-11,17-18H,3-5,8-9,12-16H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | CTRYNKIYIXXSHP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |