C17H16Cl2N2O — CID 112820101
3-[[2-(2,5-dichlorophenoxy)ethyl-methylamino]methyl]benzonitrile (PubChem CID 112820101) has the molecular formula C17H16Cl2N2O and a molecular weight of 335.23 g/mol. Its IUPAC name is 3-[[2-(2,5-dichlorophenoxy)ethyl-methylamino]methyl]benzonitrile.
| Compound Name | 3-[[2-(2,5-dichlorophenoxy)ethyl-methylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 112820101 |
| Molecular Formula | C17H16Cl2N2O |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 3-[[2-(2,5-dichlorophenoxy)ethyl-methylamino]methyl]benzonitrile |
| SMILES | CN(CCOc1cc(Cl)ccc1Cl)Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C17H16Cl2N2O/c1-21(12-14-4-2-3-13(9-14)11-20)7-8-22-17-10-15(18)5-6-16(17)19/h2-6,9-10H,7-8,12H2,1H3 |
| InChIKey | OJTRBTVWIJXSRP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |