C26H35N3O3 — CID 11282040
1-[(3aS,6S,7aS)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-ethylurea (PubChem CID 11282040) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 1-[(3aS,6S,7aS)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-ethylurea.
| Compound Name | 1-[(3aS,6S,7aS)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-ethylurea |
|---|---|
| PubChem CID | 11282040 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 1-[(3aS,6S,7aS)-1-benzyl-3a-(3,4-dimethoxyphenyl)-3,4,5,6,7,7a-hexahydro-2H-indol-6-yl]-3-ethylurea |
| SMILES | CCNC(=O)N[C@H]1CC[C@@]2(c3ccc(OC)c(OC)c3)CCN(Cc3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C26H35N3O3/c1-4-27-25(30)28-21-12-13-26(20-10-11-22(31-2)23(16-20)32-3)14-15-29(24(26)17-21)18-19-8-6-5-7-9-19/h5-11,16,21,24H,4,12-15,17-18H2,1-3H3,(H2,27,28,30)/t21-,24-,26-/m0/s1 |
| InChIKey | HGAIPTSHWFDJEH-CVJWPJSTSA-N |
| XLogP | 4.09 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |