C21H19Cl3N4O3 — CID 112821072
[4-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-(2,3,5-trichloro-6-hydroxyphenyl)methanone (PubChem CID 112821072) has the molecular formula C21H19Cl3N4O3 and a molecular weight of 481.77 g/mol. Its IUPAC name is [4-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-(2,3,5-trichloro-6-hydroxyphenyl)methanone.
| Compound Name | [4-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-(2,3,5-trichloro-6-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 112821072 |
| Molecular Formula | C21H19Cl3N4O3 |
| Molecular Weight | 481.77 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | [4-[[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperazin-1-yl]-(2,3,5-trichloro-6-hydroxyphenyl)methanone |
| SMILES | Cc1ccc(-c2noc(CN3CCN(C(=O)c4c(O)c(Cl)cc(Cl)c4Cl)CC3)n2)cc1 |
| InChI | InChI=1S/C21H19Cl3N4O3/c1-12-2-4-13(5-3-12)20-25-16(31-26-20)11-27-6-8-28(9-7-27)21(30)17-18(24)14(22)10-15(23)19(17)29/h2-5,10,29H,6-9,11H2,1H3 |
| InChIKey | LDAVUCMRONIVPR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|