C19H17Cl3N2O3 — CID 112821181
2,3,5-trichloro-6-hydroxy-N-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]benzamide (PubChem CID 112821181) has the molecular formula C19H17Cl3N2O3 and a molecular weight of 427.72 g/mol. Its IUPAC name is 2,3,5-trichloro-6-hydroxy-N-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]benzamide.
| Compound Name | 2,3,5-trichloro-6-hydroxy-N-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 112821181 |
| Molecular Formula | C19H17Cl3N2O3 |
| Molecular Weight | 427.72 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 2,3,5-trichloro-6-hydroxy-N-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccccc1CN1CCCC1=O)c1c(O)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C19H17Cl3N2O3/c20-13-8-14(21)18(26)16(17(13)22)19(27)23-9-11-4-1-2-5-12(11)10-24-7-3-6-15(24)25/h1-2,4-5,8,26H,3,6-7,9-10H2,(H,23,27) |
| InChIKey | IMTXGVNSDZHODF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.72 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|