C20H19Cl3N2O3 — CID 112821217
(4-ethylphenyl)-[4-(2,3,5-trichloro-6-hydroxybenzoyl)piperazin-1-yl]methanone (PubChem CID 112821217) has the molecular formula C20H19Cl3N2O3 and a molecular weight of 441.74 g/mol. Its IUPAC name is (4-ethylphenyl)-[4-(2,3,5-trichloro-6-hydroxybenzoyl)piperazin-1-yl]methanone.
| Compound Name | (4-ethylphenyl)-[4-(2,3,5-trichloro-6-hydroxybenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 112821217 |
| Molecular Formula | C20H19Cl3N2O3 |
| Molecular Weight | 441.74 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | (4-ethylphenyl)-[4-(2,3,5-trichloro-6-hydroxybenzoyl)piperazin-1-yl]methanone |
| SMILES | CCc1ccc(C(=O)N2CCN(C(=O)c3c(O)c(Cl)cc(Cl)c3Cl)CC2)cc1 |
| InChI | InChI=1S/C20H19Cl3N2O3/c1-2-12-3-5-13(6-4-12)19(27)24-7-9-25(10-8-24)20(28)16-17(23)14(21)11-15(22)18(16)26/h3-6,11,26H,2,7-10H2,1H3 |
| InChIKey | RJGOAGCPKLRXMC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.74 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|