C14H16Cl3NO2 — CID 112821470
(3-ethylpiperidin-1-yl)-(2,3,5-trichloro-6-hydroxyphenyl)methanone (PubChem CID 112821470) has the molecular formula C14H16Cl3NO2 and a molecular weight of 336.65 g/mol. Its IUPAC name is (3-ethylpiperidin-1-yl)-(2,3,5-trichloro-6-hydroxyphenyl)methanone.
| Compound Name | (3-ethylpiperidin-1-yl)-(2,3,5-trichloro-6-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 112821470 |
| Molecular Formula | C14H16Cl3NO2 |
| Molecular Weight | 336.65 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | (3-ethylpiperidin-1-yl)-(2,3,5-trichloro-6-hydroxyphenyl)methanone |
| SMILES | CCC1CCCN(C(=O)c2c(O)c(Cl)cc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C14H16Cl3NO2/c1-2-8-4-3-5-18(7-8)14(20)11-12(17)9(15)6-10(16)13(11)19/h6,8,19H,2-5,7H2,1H3 |
| InChIKey | LUTTUEMNOIEVBO-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|