C20H21N3O — CID 112821536
N-(2-naphthalen-2-ylethyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide (PubChem CID 112821536) has the molecular formula C20H21N3O and a molecular weight of 319.41 g/mol. Its IUPAC name is N-(2-naphthalen-2-ylethyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide.
| Compound Name | N-(2-naphthalen-2-ylethyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 112821536 |
| Molecular Formula | C20H21N3O |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | N-(2-naphthalen-2-ylethyl)-4,5,6,7-tetrahydro-1H-indazole-3-carboxamide |
| SMILES | O=C(NCCc1ccc2ccccc2c1)c1n[nH]c2c1CCCC2 |
| InChI | InChI=1S/C20H21N3O/c24-20(19-17-7-3-4-8-18(17)22-23-19)21-12-11-14-9-10-15-5-1-2-6-16(15)13-14/h1-2,5-6,9-10,13H,3-4,7-8,11-12H2,(H,21,24)(H,22,23) |
| InChIKey | MNFACCHZMCYOGQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |