C23H23N3O3S — CID 112821607
1-benzyl-N-[4-(2-methoxyethoxy)phenyl]-3-methylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 112821607) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is 1-benzyl-N-[4-(2-methoxyethoxy)phenyl]-3-methylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | 1-benzyl-N-[4-(2-methoxyethoxy)phenyl]-3-methylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 112821607 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 1-benzyl-N-[4-(2-methoxyethoxy)phenyl]-3-methylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | COCCOc1ccc(NC(=O)c2cc3c(C)nn(Cc4ccccc4)c3s2)cc1 |
| InChI | InChI=1S/C23H23N3O3S/c1-16-20-14-21(30-23(20)26(25-16)15-17-6-4-3-5-7-17)22(27)24-18-8-10-19(11-9-18)29-13-12-28-2/h3-11,14H,12-13,15H2,1-2H3,(H,24,27) |
| InChIKey | SZYNOMJOAXSZKP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|