C11H7F6IO4 — CID 11282201
[(2-methylphenyl)-(2,2,2-trifluoroacetyl)oxy-λ3-iodanyl] 2,2,2-trifluoroacetate (PubChem CID 11282201) has the molecular formula C11H7F6IO4 and a molecular weight of 444.07 g/mol. Its IUPAC name is [(2-methylphenyl)-(2,2,2-trifluoroacetyl)oxy-λ3-iodanyl] 2,2,2-trifluoroacetate.
| Compound Name | [(2-methylphenyl)-(2,2,2-trifluoroacetyl)oxy-λ3-iodanyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11282201 |
| Molecular Formula | C11H7F6IO4 |
| Molecular Weight | 444.07 g/mol |
| Exact Mass | 443.93 |
| IUPAC Name | [(2-methylphenyl)-(2,2,2-trifluoroacetyl)oxy-λ3-iodanyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1ccccc1I(OC(=O)C(F)(F)F)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H7F6IO4/c1-6-4-2-3-5-7(6)18(21-8(19)10(12,13)14)22-9(20)11(15,16)17/h2-5H,1H3 |
| InChIKey | LDZVMJLBVGBZTH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.07 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|