C11H17Cl3INO3 — CID 11282213
(4S,5R)-4-[(1S,2S)-1-iodo-3-(methoxymethoxy)-2-methylpropyl]-5-methyl-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole (PubChem CID 11282213) has the molecular formula C11H17Cl3INO3 and a molecular weight of 444.52 g/mol. Its IUPAC name is (4S,5R)-4-[(1S,2S)-1-iodo-3-(methoxymethoxy)-2-methylpropyl]-5-methyl-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S,5R)-4-[(1S,2S)-1-iodo-3-(methoxymethoxy)-2-methylpropyl]-5-methyl-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 11282213 |
| Molecular Formula | C11H17Cl3INO3 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 442.93 |
| IUPAC Name | (4S,5R)-4-[(1S,2S)-1-iodo-3-(methoxymethoxy)-2-methylpropyl]-5-methyl-2-(trichloromethyl)-4,5-dihydro-1,3-oxazole |
| SMILES | COCOC[C@H](C)[C@H](I)[C@H]1N=C(C(Cl)(Cl)Cl)O[C@@H]1C |
| InChI | InChI=1S/C11H17Cl3INO3/c1-6(4-18-5-17-3)8(15)9-7(2)19-10(16-9)11(12,13)14/h6-9H,4-5H2,1-3H3/t6-,7+,8-,9-/m0/s1 |
| InChIKey | HJAPCBAYXZEEKD-KZVJFYERSA-N |
| XLogP | 3.60 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|