C24H22N4O5 — CID 11282249
methyl (7S,8S,8aR)-3-benzyl-7-nitro-6-oxo-8-phenyl-4,7,8,9-tetrahydroimidazo[4,5-f]indolizine-8a-carboxylate (PubChem CID 11282249) has the molecular formula C24H22N4O5 and a molecular weight of 446.46 g/mol. Its IUPAC name is methyl (7S,8S,8aR)-3-benzyl-7-nitro-6-oxo-8-phenyl-4,7,8,9-tetrahydroimidazo[4,5-f]indolizine-8a-carboxylate.
| Compound Name | methyl (7S,8S,8aR)-3-benzyl-7-nitro-6-oxo-8-phenyl-4,7,8,9-tetrahydroimidazo[4,5-f]indolizine-8a-carboxylate |
|---|---|
| PubChem CID | 11282249 |
| Molecular Formula | C24H22N4O5 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | methyl (7S,8S,8aR)-3-benzyl-7-nitro-6-oxo-8-phenyl-4,7,8,9-tetrahydroimidazo[4,5-f]indolizine-8a-carboxylate |
| SMILES | COC(=O)[C@]12Cc3ncn(Cc4ccccc4)c3CN1C(=O)[C@@H]([N+](=O)[O-])[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C24H22N4O5/c1-33-23(30)24-12-18-19(26(15-25-18)13-16-8-4-2-5-9-16)14-27(24)22(29)21(28(31)32)20(24)17-10-6-3-7-11-17/h2-11,15,20-21H,12-14H2,1H3/t20-,21-,24+/m0/s1 |
| InChIKey | DCMXSUBAGZAMGR-AWRGLXIESA-N |
| XLogP | 2.17 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|