C21H24FNO2 — CID 112822520
2-(2,3-dihydro-1H-inden-5-yl)-N-[3-(4-fluorophenoxy)propyl]-N-methylacetamide (PubChem CID 112822520) has the molecular formula C21H24FNO2 and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yl)-N-[3-(4-fluorophenoxy)propyl]-N-methylacetamide.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yl)-N-[3-(4-fluorophenoxy)propyl]-N-methylacetamide |
|---|---|
| PubChem CID | 112822520 |
| Molecular Formula | C21H24FNO2 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yl)-N-[3-(4-fluorophenoxy)propyl]-N-methylacetamide |
| SMILES | CN(CCCOc1ccc(F)cc1)C(=O)Cc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C21H24FNO2/c1-23(12-3-13-25-20-10-8-19(22)9-11-20)21(24)15-16-6-7-17-4-2-5-18(17)14-16/h6-11,14H,2-5,12-13,15H2,1H3 |
| InChIKey | IDFFQWLTEGFBSK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|