C25H38O7 — CID 11282367
[(1R,2E,4S,6Z,9E,11R)-4-(3,4-dihydroxy-4-methylpentyl)-11-hydroxy-7-(hydroxymethyl)-4,11-dimethyl-8-oxocycloundeca-2,6,9-trien-1-yl] 3-methylbut-2-enoate (PubChem CID 11282367) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is [(1R,2E,4S,6Z,9E,11R)-4-(3,4-dihydroxy-4-methylpentyl)-11-hydroxy-7-(hydroxymethyl)-4,11-dimethyl-8-oxocycloundeca-2,6,9-trien-1-yl] 3-methylbut-2-enoate.
| Compound Name | [(1R,2E,4S,6Z,9E,11R)-4-(3,4-dihydroxy-4-methylpentyl)-11-hydroxy-7-(hydroxymethyl)-4,11-dimethyl-8-oxocycloundeca-2,6,9-trien-1-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 11282367 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | [(1R,2E,4S,6Z,9E,11R)-4-(3,4-dihydroxy-4-methylpentyl)-11-hydroxy-7-(hydroxymethyl)-4,11-dimethyl-8-oxocycloundeca-2,6,9-trien-1-yl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)O[C@@H]1/C=C/[C@@](C)(CCC(O)C(C)(C)O)C/C=C(/CO)C(=O)/C=C/[C@@]1(C)O |
| InChI | InChI=1S/C25H38O7/c1-17(2)15-22(29)32-21-10-13-24(5,12-9-20(28)23(3,4)30)11-7-18(16-26)19(27)8-14-25(21,6)31/h7-8,10,13-15,20-21,26,28,30-31H,9,11-12,16H2,1-6H3/b13-10+,14-8+,18-7-/t20?,21-,24-,25-/m1/s1 |
| InChIKey | GFAQUYIQNBAVAL-WQPDWFRBSA-N |
| XLogP | 2.54 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|