C18H24ClNO2S — CID 112823744
2-[2-(4-chlorophenoxy)ethylsulfanyl]-N-cyclopentyl-N-cyclopropylacetamide (PubChem CID 112823744) has the molecular formula C18H24ClNO2S and a molecular weight of 353.92 g/mol. Its IUPAC name is 2-[2-(4-chlorophenoxy)ethylsulfanyl]-N-cyclopentyl-N-cyclopropylacetamide.
| Compound Name | 2-[2-(4-chlorophenoxy)ethylsulfanyl]-N-cyclopentyl-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 112823744 |
| Molecular Formula | C18H24ClNO2S |
| Molecular Weight | 353.92 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 2-[2-(4-chlorophenoxy)ethylsulfanyl]-N-cyclopentyl-N-cyclopropylacetamide |
| SMILES | O=C(CSCCOc1ccc(Cl)cc1)N(C1CCCC1)C1CC1 |
| InChI | InChI=1S/C18H24ClNO2S/c19-14-5-9-17(10-6-14)22-11-12-23-13-18(21)20(16-7-8-16)15-3-1-2-4-15/h5-6,9-10,15-16H,1-4,7-8,11-13H2 |
| InChIKey | IJIMKTFZPHIZRT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.92 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|