C24H28N4O — CID 112823868
(1-benzyl-5-ethylpyrazol-4-yl)-[4-(2-methylphenyl)piperazin-1-yl]methanone (PubChem CID 112823868) has the molecular formula C24H28N4O and a molecular weight of 388.52 g/mol. Its IUPAC name is (1-benzyl-5-ethylpyrazol-4-yl)-[4-(2-methylphenyl)piperazin-1-yl]methanone.
| Compound Name | (1-benzyl-5-ethylpyrazol-4-yl)-[4-(2-methylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 112823868 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | (1-benzyl-5-ethylpyrazol-4-yl)-[4-(2-methylphenyl)piperazin-1-yl]methanone |
| SMILES | CCc1c(C(=O)N2CCN(c3ccccc3C)CC2)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C24H28N4O/c1-3-22-21(17-25-28(22)18-20-10-5-4-6-11-20)24(29)27-15-13-26(14-16-27)23-12-8-7-9-19(23)2/h4-12,17H,3,13-16,18H2,1-2H3 |
| InChIKey | WRSUNLDDFNOAFA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |