C17H22FNO2S — CID 112823935
N-(2-adamantyl)-5-fluoro-2-methylbenzenesulfonamide (PubChem CID 112823935) has the molecular formula C17H22FNO2S and a molecular weight of 323.43 g/mol. Its IUPAC name is N-(2-adamantyl)-5-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-(2-adamantyl)-5-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 112823935 |
| Molecular Formula | C17H22FNO2S |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-(2-adamantyl)-5-fluoro-2-methylbenzenesulfonamide |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C17H22FNO2S/c1-10-2-3-15(18)9-16(10)22(20,21)19-17-13-5-11-4-12(7-13)8-14(17)6-11/h2-3,9,11-14,17,19H,4-8H2,1H3 |
| InChIKey | ZHHBELPILBGZAN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |