About ethyl (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloct-2-enoate
ethyl (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloct-2-enoate (PubChem CID 11282409) has the molecular formula C28H40O3Si
and a molecular weight of 452.71 g/mol. Its IUPAC name is ethyl (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloct-2-enoate.
Molecular Properties
| Compound Name | ethyl (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloct-2-enoate |
| PubChem CID | 11282409 |
| Molecular Formula | C28H40O3Si |
| Molecular Weight | 452.71 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | ethyl (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloct-2-enoate |
| SMILES | CCOC(=O)/C=C(/C)CCCC(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H40O3Si/c1-7-30-27(29)21-23(2)15-14-16-24(3)22-31-32(28(4,5)6,25-17-10-8-11-18-25)26-19-12-9-13-20-26/h8-13,17-21,24H,7,14-16,22H2,1-6H3/b23-21- |
| InChIKey | FICFYQAPYOSDNO-LNVKXUELSA-N |
| XLogP | 5.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.71 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloct-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloct-2-enoate?
The IUPAC name of ethyl (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloct-2-enoate (CID 11282409) is ethyl (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloct-2-enoate.
What is the SMILES notation for ethyl (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloct-2-enoate?
The canonical SMILES for ethyl (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloct-2-enoate is CCOC(=O)/C=C(/C)CCCC(C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of ethyl (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloct-2-enoate?
The InChIKey is FICFYQAPYOSDNO-LNVKXUELSA-N. The full InChI is InChI=1S/C28H40O3Si/c1-7-30-27(29)21-23(2)15-14-16-24(3)22-31-32(28(4,5)6,25-17-10-8-11-18-25)26-19-12-9-13-20-26/h8-13,17-21,24H,7,14-16,22H2,1-6H3/b23-21-.
What are the key properties of ethyl (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloct-2-enoate?
ethyl (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloct-2-enoate has a molecular weight of 452.71 g/mol, XLogP of 5.88, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (Z)-8-[tert-butyl(diphenyl)silyl]oxy-3,7-dimethyloct-2-enoate is sourced from PubChem (CID 11282409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).