C26H26N2O4 — CID 112824255
N-[1-(3-benzamidophenyl)ethyl]-6-methoxy-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 112824255) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is N-[1-(3-benzamidophenyl)ethyl]-6-methoxy-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | N-[1-(3-benzamidophenyl)ethyl]-6-methoxy-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 112824255 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-[1-(3-benzamidophenyl)ethyl]-6-methoxy-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | COc1ccc2c(c1)CC(C(=O)NC(C)c1cccc(NC(=O)c3ccccc3)c1)CO2 |
| InChI | InChI=1S/C26H26N2O4/c1-17(19-9-6-10-22(14-19)28-25(29)18-7-4-3-5-8-18)27-26(30)21-13-20-15-23(31-2)11-12-24(20)32-16-21/h3-12,14-15,17,21H,13,16H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | NEIPZILIDXFHLK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |