C20H21IN2O3 — CID 112824394
N-(4-iodophenyl)-4-(4-methoxybenzoyl)piperidine-1-carboxamide (PubChem CID 112824394) has the molecular formula C20H21IN2O3 and a molecular weight of 464.30 g/mol. Its IUPAC name is N-(4-iodophenyl)-4-(4-methoxybenzoyl)piperidine-1-carboxamide.
| Compound Name | N-(4-iodophenyl)-4-(4-methoxybenzoyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 112824394 |
| Molecular Formula | C20H21IN2O3 |
| Molecular Weight | 464.30 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | N-(4-iodophenyl)-4-(4-methoxybenzoyl)piperidine-1-carboxamide |
| SMILES | COc1ccc(C(=O)C2CCN(C(=O)Nc3ccc(I)cc3)CC2)cc1 |
| InChI | InChI=1S/C20H21IN2O3/c1-26-18-8-2-14(3-9-18)19(24)15-10-12-23(13-11-15)20(25)22-17-6-4-16(21)5-7-17/h2-9,15H,10-13H2,1H3,(H,22,25) |
| InChIKey | QYIFQGYRDXORLS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|