C22H32F2N4O2S — CID 11282450
2,2-difluoro-3-methyl-1-[5-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-4-yl]thiophen-2-yl]butane-1,3-diol (PubChem CID 11282450) has the molecular formula C22H32F2N4O2S and a molecular weight of 454.59 g/mol. Its IUPAC name is 2,2-difluoro-3-methyl-1-[5-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-4-yl]thiophen-2-yl]butane-1,3-diol.
| Compound Name | 2,2-difluoro-3-methyl-1-[5-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-4-yl]thiophen-2-yl]butane-1,3-diol |
|---|---|
| PubChem CID | 11282450 |
| Molecular Formula | C22H32F2N4O2S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 2,2-difluoro-3-methyl-1-[5-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-4-yl]thiophen-2-yl]butane-1,3-diol |
| SMILES | CC1(C)CC(Nc2nccc(-c3ccc(C(O)C(F)(F)C(C)(C)O)s3)n2)CC(C)(C)N1 |
| InChI | InChI=1S/C22H32F2N4O2S/c1-19(2)11-13(12-20(3,4)28-19)26-18-25-10-9-14(27-18)15-7-8-16(31-15)17(29)22(23,24)21(5,6)30/h7-10,13,17,28-30H,11-12H2,1-6H3,(H,25,26,27) |
| InChIKey | RNMDLJLXTPAGPJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |