About 1-(4-cyclopropyl-1,3-thiazol-2-yl)-3-[2-(4-methylphenyl)sulfanylethyl]urea
1-(4-cyclopropyl-1,3-thiazol-2-yl)-3-[2-(4-methylphenyl)sulfanylethyl]urea (PubChem CID 112825265) has the molecular formula C16H19N3OS2
and a molecular weight of 333.48 g/mol. Its IUPAC name is 1-(4-cyclopropyl-1,3-thiazol-2-yl)-3-[2-(4-methylphenyl)sulfanylethyl]urea.
Molecular Properties
| Compound Name | 1-(4-cyclopropyl-1,3-thiazol-2-yl)-3-[2-(4-methylphenyl)sulfanylethyl]urea |
| PubChem CID | 112825265 |
| Molecular Formula | C16H19N3OS2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1-(4-cyclopropyl-1,3-thiazol-2-yl)-3-[2-(4-methylphenyl)sulfanylethyl]urea |
| SMILES | Cc1ccc(SCCNC(=O)Nc2nc(C3CC3)cs2)cc1 |
| InChI | InChI=1S/C16H19N3OS2/c1-11-2-6-13(7-3-11)21-9-8-17-15(20)19-16-18-14(10-22-16)12-4-5-12/h2-3,6-7,10,12H,4-5,8-9H2,1H3,(H2,17,18,19,20) |
| InChIKey | ZPKRXKHJSLRXNO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-cyclopropyl-1,3-thiazol-2-yl)-3-[2-(4-methylphenyl)sulfanylethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-cyclopropyl-1,3-thiazol-2-yl)-3-[2-(4-methylphenyl)sulfanylethyl]urea?
The IUPAC name of 1-(4-cyclopropyl-1,3-thiazol-2-yl)-3-[2-(4-methylphenyl)sulfanylethyl]urea (CID 112825265) is 1-(4-cyclopropyl-1,3-thiazol-2-yl)-3-[2-(4-methylphenyl)sulfanylethyl]urea.
What is the SMILES notation for 1-(4-cyclopropyl-1,3-thiazol-2-yl)-3-[2-(4-methylphenyl)sulfanylethyl]urea?
The canonical SMILES for 1-(4-cyclopropyl-1,3-thiazol-2-yl)-3-[2-(4-methylphenyl)sulfanylethyl]urea is Cc1ccc(SCCNC(=O)Nc2nc(C3CC3)cs2)cc1.
What is the InChIKey of 1-(4-cyclopropyl-1,3-thiazol-2-yl)-3-[2-(4-methylphenyl)sulfanylethyl]urea?
The InChIKey is ZPKRXKHJSLRXNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3OS2/c1-11-2-6-13(7-3-11)21-9-8-17-15(20)19-16-18-14(10-22-16)12-4-5-12/h2-3,6-7,10,12H,4-5,8-9H2,1H3,(H2,17,18,19,20).
What are the key properties of 1-(4-cyclopropyl-1,3-thiazol-2-yl)-3-[2-(4-methylphenyl)sulfanylethyl]urea?
1-(4-cyclopropyl-1,3-thiazol-2-yl)-3-[2-(4-methylphenyl)sulfanylethyl]urea has a molecular weight of 333.48 g/mol, XLogP of 4.24, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-cyclopropyl-1,3-thiazol-2-yl)-3-[2-(4-methylphenyl)sulfanylethyl]urea is sourced from PubChem (CID 112825265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).