C24H25N3O3 — CID 112825512
4-(oxolane-2-carbonyl)-N-[3-(2-phenylethynyl)phenyl]piperazine-1-carboxamide (PubChem CID 112825512) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 4-(oxolane-2-carbonyl)-N-[3-(2-phenylethynyl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-(oxolane-2-carbonyl)-N-[3-(2-phenylethynyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 112825512 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 4-(oxolane-2-carbonyl)-N-[3-(2-phenylethynyl)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(Nc1cccc(C#Cc2ccccc2)c1)N1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C24H25N3O3/c28-23(22-10-5-17-30-22)26-13-15-27(16-14-26)24(29)25-21-9-4-8-20(18-21)12-11-19-6-2-1-3-7-19/h1-4,6-9,18,22H,5,10,13-17H2,(H,25,29) |
| InChIKey | KJWHNGKEELYJHL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|