C25H34N2O4S — CID 11282554
methyl 3-[(3R)-1-[(1S,5R,7R)-10,10-dimethyl-2-oxo-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-4-yl]-1-oxopentan-3-yl]sulfanylpropanoate (PubChem CID 11282554) has the molecular formula C25H34N2O4S and a molecular weight of 458.62 g/mol. Its IUPAC name is methyl 3-[(3R)-1-[(1S,5R,7R)-10,10-dimethyl-2-oxo-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-4-yl]-1-oxopentan-3-yl]sulfanylpropanoate.
| Compound Name | methyl 3-[(3R)-1-[(1S,5R,7R)-10,10-dimethyl-2-oxo-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-4-yl]-1-oxopentan-3-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 11282554 |
| Molecular Formula | C25H34N2O4S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | methyl 3-[(3R)-1-[(1S,5R,7R)-10,10-dimethyl-2-oxo-3-phenyl-3,4-diazatricyclo[5.2.1.01,5]decan-4-yl]-1-oxopentan-3-yl]sulfanylpropanoate |
| SMILES | CC[C@H](CC(=O)N1[C@@H]2C[C@H]3CC[C@]2(C(=O)N1c1ccccc1)C3(C)C)SCCC(=O)OC |
| InChI | InChI=1S/C25H34N2O4S/c1-5-19(32-14-12-22(29)31-4)16-21(28)27-20-15-17-11-13-25(20,24(17,2)3)23(30)26(27)18-9-7-6-8-10-18/h6-10,17,19-20H,5,11-16H2,1-4H3/t17-,19-,20-,25+/m1/s1 |
| InChIKey | JJFOWZISMZBGFM-ILDDTBCLSA-N |
| XLogP | 4.44 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |