C15H13ClIN5O — CID 112825620
1-(2-chloro-4-iodophenyl)-3-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]urea (PubChem CID 112825620) has the molecular formula C15H13ClIN5O and a molecular weight of 441.66 g/mol. Its IUPAC name is 1-(2-chloro-4-iodophenyl)-3-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]urea.
| Compound Name | 1-(2-chloro-4-iodophenyl)-3-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 112825620 |
| Molecular Formula | C15H13ClIN5O |
| Molecular Weight | 441.66 g/mol |
| Exact Mass | 440.99 |
| IUPAC Name | 1-(2-chloro-4-iodophenyl)-3-[1-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]urea |
| SMILES | CC(NC(=O)Nc1ccc(I)cc1Cl)c1nnc2ccccn12 |
| InChI | InChI=1S/C15H13ClIN5O/c1-9(14-21-20-13-4-2-3-7-22(13)14)18-15(23)19-12-6-5-10(17)8-11(12)16/h2-9H,1H3,(H2,18,19,23) |
| InChIKey | UANGTIKWQHPEDX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.66 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|