C22H20N8O4 — CID 11282593
ethyl 2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate (PubChem CID 11282593) has the molecular formula C22H20N8O4 and a molecular weight of 460.45 g/mol. Its IUPAC name is ethyl 2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate |
|---|---|
| PubChem CID | 11282593 |
| Molecular Formula | C22H20N8O4 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | ethyl 2-[4-[[4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]carbamoylamino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(NC(=O)Nc2nc3nn(C)cc3c3nc(-c4ccco4)nn23)cc1 |
| InChI | InChI=1S/C22H20N8O4/c1-3-33-17(31)11-13-6-8-14(9-7-13)23-22(32)26-21-25-18-15(12-29(2)27-18)20-24-19(28-30(20)21)16-5-4-10-34-16/h4-10,12H,3,11H2,1-2H3,(H2,23,25,26,27,32) |
| InChIKey | ITXJPDGGAJBZGX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 141.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |