C20H27F3N4OS — CID 112826194
N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-3-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]propanamide (PubChem CID 112826194) has the molecular formula C20H27F3N4OS and a molecular weight of 428.52 g/mol. Its IUPAC name is N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-3-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]propanamide.
| Compound Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-3-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]propanamide |
|---|---|
| PubChem CID | 112826194 |
| Molecular Formula | C20H27F3N4OS |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | N-(3-cyano-5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)-3-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]propanamide |
| SMILES | N#Cc1c(NC(=O)CCN2CCCN(CC(F)(F)F)CC2)sc2c1CCCCC2 |
| InChI | InChI=1S/C20H27F3N4OS/c21-20(22,23)14-27-9-4-8-26(11-12-27)10-7-18(28)25-19-16(13-24)15-5-2-1-3-6-17(15)29-19/h1-12,14H2,(H,25,28) |
| InChIKey | JYOOELYLAYVNGB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |