About N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[(4-bromophenyl)methylsulfonyl]acetamide
N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[(4-bromophenyl)methylsulfonyl]acetamide (PubChem CID 112826317) has the molecular formula C22H24BrN3O3S
and a molecular weight of 490.42 g/mol. Its IUPAC name is N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[(4-bromophenyl)methylsulfonyl]acetamide.
Molecular Properties
| Compound Name | N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[(4-bromophenyl)methylsulfonyl]acetamide |
| PubChem CID | 112826317 |
| Molecular Formula | C22H24BrN3O3S |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[(4-bromophenyl)methylsulfonyl]acetamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1CNC(=O)CS(=O)(=O)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H24BrN3O3S/c1-16-21(17(2)26(25-16)13-18-6-4-3-5-7-18)12-24-22(27)15-30(28,29)14-19-8-10-20(23)11-9-19/h3-11H,12-15H2,1-2H3,(H,24,27) |
| InChIKey | FYEYEEVJYFKSMM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[(4-bromophenyl)methylsulfonyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[(4-bromophenyl)methylsulfonyl]acetamide?
The IUPAC name of N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[(4-bromophenyl)methylsulfonyl]acetamide (CID 112826317) is N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[(4-bromophenyl)methylsulfonyl]acetamide.
What is the SMILES notation for N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[(4-bromophenyl)methylsulfonyl]acetamide?
The canonical SMILES for N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[(4-bromophenyl)methylsulfonyl]acetamide is Cc1nn(Cc2ccccc2)c(C)c1CNC(=O)CS(=O)(=O)Cc1ccc(Br)cc1.
What is the InChIKey of N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[(4-bromophenyl)methylsulfonyl]acetamide?
The InChIKey is FYEYEEVJYFKSMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24BrN3O3S/c1-16-21(17(2)26(25-16)13-18-6-4-3-5-7-18)12-24-22(27)15-30(28,29)14-19-8-10-20(23)11-9-19/h3-11H,12-15H2,1-2H3,(H,24,27).
What are the key properties of N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[(4-bromophenyl)methylsulfonyl]acetamide?
N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[(4-bromophenyl)methylsulfonyl]acetamide has a molecular weight of 490.42 g/mol, XLogP of 3.54, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-2-[(4-bromophenyl)methylsulfonyl]acetamide is sourced from PubChem (CID 112826317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).