C19H19F3N2O2S — CID 112828165
3,3-diethyl-1-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 112828165) has the molecular formula C19H19F3N2O2S and a molecular weight of 396.43 g/mol. Its IUPAC name is 3,3-diethyl-1-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 3,3-diethyl-1-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 112828165 |
| Molecular Formula | C19H19F3N2O2S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 3,3-diethyl-1-[[2-[4-(trifluoromethyl)phenyl]-1,3-thiazol-4-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | CCC1(CC)CC(=O)N(Cc2csc(-c3ccc(C(F)(F)F)cc3)n2)C1=O |
| InChI | InChI=1S/C19H19F3N2O2S/c1-3-18(4-2)9-15(25)24(17(18)26)10-14-11-27-16(23-14)12-5-7-13(8-6-12)19(20,21)22/h5-8,11H,3-4,9-10H2,1-2H3 |
| InChIKey | IQBFPZFJDPBDJL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|