C28H30N4O2S — CID 112828637
2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-(3-imidazol-1-ylphenyl)benzamide (PubChem CID 112828637) has the molecular formula C28H30N4O2S and a molecular weight of 486.64 g/mol. Its IUPAC name is 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-(3-imidazol-1-ylphenyl)benzamide.
| Compound Name | 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-(3-imidazol-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 112828637 |
| Molecular Formula | C28H30N4O2S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 2-[2-(1-adamantylamino)-2-oxoethyl]sulfanyl-N-(3-imidazol-1-ylphenyl)benzamide |
| SMILES | O=C(CSc1ccccc1C(=O)Nc1cccc(-n2ccnc2)c1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H30N4O2S/c33-26(31-28-14-19-10-20(15-28)12-21(11-19)16-28)17-35-25-7-2-1-6-24(25)27(34)30-22-4-3-5-23(13-22)32-9-8-29-18-32/h1-9,13,18-21H,10-12,14-17H2,(H,30,34)(H,31,33) |
| InChIKey | WMHXYNWWLKZMTM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |